CymitQuimica logo

CAS 638156-11-3

:

CID-2011756

Description:
CID-2011756, also known by its CAS number 638156-11-3, is a chemical compound that belongs to the class of small molecules. It is characterized by its specific molecular structure, which includes various functional groups that contribute to its chemical properties and biological activity. This compound has been studied for its potential applications in medicinal chemistry, particularly in the context of drug development. Its solubility, stability, and reactivity are influenced by its molecular configuration, which can affect its interaction with biological targets. Additionally, CID-2011756 may exhibit specific pharmacological effects, making it a subject of interest in research related to therapeutic agents. The compound's safety profile, including toxicity and environmental impact, is also an important consideration in its application. Overall, CID-2011756 represents a significant entity in the realm of chemical research, with ongoing studies aimed at elucidating its full potential and mechanisms of action.
Formula:C22H21ClN2O3
InChI:InChI=1S/C22H21ClN2O3/c23-18-3-1-2-17(14-18)20-8-9-21(28-20)22(26)24-19-6-4-16(5-7-19)15-25-10-12-27-13-11-25/h1-9,14H,10-13,15H2,(H,24,26)
InChI key:XQJWTJLJEYIUDZ-UHFFFAOYSA-N
SMILES:C1COCCN1CC2=CC=C(C=C2)NC(=O)C3=CC=C(O3)C4=CC(=CC=C4)Cl
Found 4 products.