CAS 638160-09-5
:5-(4-Chloro-3-nitrophenyl)-2-furoyl chloride
Description:
5-(4-Chloro-3-nitrophenyl)-2-furoyl chloride is an organic compound characterized by its furoyl chloride structure, which incorporates a furan ring and a chlorinated nitrophenyl group. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The chlorinated and nitro-substituted phenyl moiety enhances its electrophilic character, making it useful in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety precautions are necessary when handling this substance, as it may be corrosive and harmful upon exposure. Proper storage conditions should be maintained to ensure stability and prevent degradation.
Formula:C11H5Cl2NO4
InChI:InChI=1/C11H5Cl2NO4/c12-7-2-1-6(5-8(7)14(16)17)9-3-4-10(18-9)11(13)15/h1-5H
SMILES:c1cc(c(cc1c1ccc(C(=O)Cl)o1)N(=O)=O)Cl
Synonyms:- 2-Furancarbonyl Chloride, 5-(4-Chloro-3-Nitrophenyl)-
- 5-(4-Chloro-3-Nitrophenyl)Furan-2-Carbonyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
