CymitQuimica logo

CAS 6386-24-9

:

2,3,4,6-Tetrakis-O-(phenylmethyl)-D-galactopyranose

Description:
2,3,4,6-Tetrakis-O-(phenylmethyl)-D-galactopyranose is a derivative of D-galactose, a monosaccharide that is part of the hexose family. This compound features four phenylmethyl (benzyl) groups attached to the hydroxyl positions at carbons 2, 3, 4, and 6 of the galactopyranose ring, which significantly alters its physical and chemical properties compared to the parent sugar. The presence of these bulky phenylmethyl groups enhances the compound's hydrophobicity and can influence its solubility in organic solvents. Additionally, the substitution pattern can affect its reactivity, making it less susceptible to typical carbohydrate reactions such as oxidation or hydrolysis. This compound may exhibit interesting biological activities due to its structural modifications, potentially serving as a ligand or a building block in synthetic chemistry. Its CAS number, 6386-24-9, allows for easy identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and materials science.
Formula:C34H36O6
InChI:InChI=1S/C34H36O6/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-35H,21-25H2/t30-,31+,32+,33-,34?/m1/s1
InChI key:InChIKey=OGOMAWHSXRDAKZ-BJPULKCASA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@@H](OCC3=CC=CC=C3)[C@@H](COCC4=CC=CC=C4)OC(O)[C@@H]2OCC5=CC=CC=C5
Synonyms:
  • Galactopyranose, 2,3,4,6-tetra-O-benzyl-
  • Galactopyranose, 2,3,4,6-tetra-O-benzyl-, D-
  • 2,3,4,6-Tetrakis-O-(phenylmethyl)-D-galactopyranose
  • D-Galactopyranose, 2,3,4,6-tetrakis-O-(phenylmethyl)-
Found 8 products.