CymitQuimica logo

CAS 63873-61-0

:

4-Chlorothieno[2,3-b]pyridine-5-carbonitrile

Description:
4-Chlorothieno[2,3-b]pyridine-5-carbonitrile is a heterocyclic compound characterized by the presence of a thieno-pyridine structure, which incorporates both sulfur and nitrogen atoms in its ring system. This compound features a chlorine substituent at the 4-position and a cyano group at the 5-position, contributing to its chemical reactivity and potential applications. The thieno[2,3-b]pyridine framework is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the chlorine atom can influence the compound's lipophilicity and overall pharmacokinetic properties. Additionally, this compound may exhibit interesting electronic properties due to the conjugation within the aromatic system. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. As with many heterocycles, the synthesis and functionalization of 4-Chlorothieno[2,3-b]pyridine-5-carbonitrile can lead to a variety of derivatives with tailored properties for specific applications.
Formula:C8H3ClN2S
InChI:InChI=1S/C8H3ClN2S/c9-7-5(3-10)4-11-8-6(7)1-2-12-8/h1-2,4H
InChI key:InChIKey=MATKYBWAJURSDT-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1C#N)SC=C2
Synonyms:
  • 4-Chlorothieno[2,3-b]pyridine-5-carbonitrile
  • Thieno[2,3-b]pyridine-5-carbonitrile, 4-chloro-
Found 4 products.