CymitQuimica logo

CAS 63875-38-7

:

2-Pyridinamine, 3,5,6-tribromo-

Description:
2-Pyridinamine, 3,5,6-tribromo- is an organic compound characterized by the presence of a pyridine ring substituted with three bromine atoms at the 3, 5, and 6 positions, along with an amino group at the 2 position. This compound is part of the broader class of brominated pyridines, which are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science. The presence of multiple bromine substituents significantly influences its chemical reactivity, solubility, and potential biological activity. Typically, such brominated compounds exhibit enhanced lipophilicity, which can affect their interaction with biological systems. Additionally, the amino group contributes to the compound's basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. Safety data sheets would indicate that handling should be done with care due to the toxicity associated with brominated compounds. Overall, 2-Pyridinamine, 3,5,6-tribromo- is a compound of interest in both synthetic chemistry and biological research.
Formula:C5H3Br3N2
InChI:InChI=1S/C5H3Br3N2/c6-2-1-3(7)5(9)10-4(2)8/h1H,(H2,9,10)
InChI key:QXPFSKGRHXJUEZ-UHFFFAOYSA-N
SMILES:C1=C(C(=NC(=C1Br)Br)N)Br
Found 3 products.