CAS 6388-74-5
:2-(4-Nitrophenyl)oxirane
Description:
2-(4-Nitrophenyl)oxirane, also known as 4-nitrophenyl epoxide, is a chemical compound characterized by its epoxide functional group, which consists of a three-membered cyclic ether. The presence of the nitrophenyl group imparts significant reactivity and polarity to the molecule, making it useful in various chemical reactions, particularly in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in the synthesis of pharmaceuticals and agrochemicals, as well as in polymer chemistry. The epoxide ring is highly strained, making it reactive towards nucleophiles, which can lead to ring-opening reactions. Additionally, the nitro group can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled.
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-9(11)7-3-1-6(2-4-7)8-5-12-8/h1-4,8H,5H2
InChI key:InChIKey=YKIUTLHCSNCTDZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(C2CO2)C=C1
Synonyms:- (4-Nitrophenyl)oxirane
- 1,2-Epoxy-1-(p-nitrophenyl)ethane
- 1-(Epoxyethyl)-4-nitrobenzene
- 2-(4-Nitrophenyl)Oxirane
- 2-(p-Nitrophenyl)oxirane
- 4-Nitrostyrene epoxide
- 4-Nitrostyrene oxide
- Benzene, 1-(epoxyethyl)-4-nitro-
- Brn 0140339
- Nsc 72312
- Oxirane, (4-nitrophenyl)-
- Oxirane, (4-nitrophenyl)- (9CI)
- Oxirane, 2-(4-nitrophenyl)-
- p-Nitrostyrene oxide
- (p-Nitrophenyl)oxirane
- 5-17-01-00579 (Beilstein Handbook Reference)
- 4-Nitrophenyloxirane
- Einecs 228-998-5
- 1-(Oxiranyl)-4-nitrobenzene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4-Nitrophenyl)oxirane
CAS:Formula:C8H7NO3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:165.152-(4-Nitrophenyl)oxirane
CAS:2-(4-Nitrophenyl)oxiraneFormula:C8H7NO3Purity:97%Molecular weight:165.15Oxirane, (4-nitrophenyl)-
CAS:Formula:C8H7NO3Purity:97%Color and Shape:SolidMolecular weight:165.14612-(4-Nitrophenyl)oxirane
CAS:2-(4-Nitrophenyl)oxirane is an organic compound that is used as a reactant in organic chemistry. It has been shown to be an effective anti-inflammatory agent in vitro. This compound reacts with the hydroxyl group of epoxyethane to form a stable oxirane, which can then be oxidized by hydrogen peroxide to form an epoxide. The enantiomeric purity of 2-(4-nitrophenyl)oxirane was determined using an asymmetric synthesis and found to be greater than 99%.Formula:C8H7NO3Purity:Min. 95%Molecular weight:165.15 g/mol




