CymitQuimica logo

CAS 639084-05-2

:

tert-Butyl 3-iodo-7-methoxy-1H-indazole-1-carboxylate

Description:
Tert-Butyl 3-iodo-7-methoxy-1H-indazole-1-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The iodo substituent at the 3-position introduces a halogen, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group at the 7-position contributes to the compound's overall polarity and can influence its reactivity and biological activity. The carboxylate functional group at the 1-position is typically involved in esterification or acid-base reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity associated with halogenated compounds.
Formula:C13H15IN2O3
InChI:InChI=1S/C13H15IN2O3/c1-13(2,3)19-12(17)16-10-8(11(14)15-16)6-5-7-9(10)18-4/h5-7H,1-4H3
InChI key:HFJZJGMJVPARQO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C2=C(C=CC=C2OC)C(=N1)I
Synonyms:
  • tert-Butyl 3-iodo-7-methoxy-1H-indazole-1-carboxylate
  • 1,1-Dimethylethyl 3-iodo-7-methoxy-1H-indazole-1-carboxylate
  • 1H-Indazole-1-carboxylic acid, 3-iodo-7-methoxy-, 1,1-dimethylethyl ester
Found 4 products.