CAS 63909-29-5
:trans-3-benzyloxy-4-methoxy-beta-nitro-styrene
Description:
Trans-3-benzyloxy-4-methoxy-beta-nitro-styrene is an organic compound characterized by its complex structure, which includes a styrene backbone with various substituents. The presence of a benzyloxy group and a methoxy group contributes to its unique chemical properties, such as increased lipophilicity and potential for engaging in various chemical reactions. The beta-nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structural features suggest potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the trans configuration of the double bond in the styrene moiety is significant, as it can affect the compound's stereochemistry and interactions with biological targets. Overall, trans-3-benzyloxy-4-methoxy-beta-nitro-styrene is a versatile compound with interesting chemical behavior, making it a subject of interest in various fields of research.
Formula:C16H15NO4
InChI:InChI=1/C16H15NO4/c1-20-15-8-7-13(9-10-17(18)19)11-16(15)21-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3/b10-9+
InChI key:JNMKPRLNICRRIV-MDZDMXLPSA-N
SMILES:COC1=C(C=C(C=C1)/C=C/[N+](=O)[O-])OCC2=CC=CC=C2
Synonyms:- trans-3-Benzyloxy-4-methoxy-beta-nitrostyrene
- 2-(benzyloxy)-1-methoxy-4-[(E)-2-nitroethenyl]benzene
- 3-Benzyloxy-4-Methoxy-Β-Nitrostyrene
- Trans-3-Benzyloxy-4-Methoxy-Β-Nitrostyrene
- (E)-1-Methoxy-4-(2-nitroethenyl)-2-(phenylmethoxy)benzene
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Benzyloxy-4-methoxy-β-nitrostyrene
CAS:3-Benzyloxy-4-methoxy-β-nitrostyreneFormula:C16H15NO4Purity:95%Molecular weight:285.2946trans-3-Benzyloxy-4-methoxy-β-nitrostyrene
CAS:Formula:C16H15NO4Purity:95%Color and Shape:SolidMolecular weight:285.29461-(3-Benzyloxy-4-methoxyphenyl)-2-nitroethene
CAS:1-(3-Benzyloxy-4-methoxyphenyl)-2-nitroethene (1BMN) is an ethanamine that has a skeleton of five benzene and one methoxybenzene rings. It is an analogue of lamellarin, which has been shown to have efficient synthetic and biological properties. 1BMN is biologically active as a lamellarin analog and may be useful for the treatment of diseases such as cancer, malaria, hypertension, hyperglycemia, hypercholesterolemia, and ulcerative colitis. 1BMN is synthesized from 2-nitroethanol by reacting with 3-bromobenzaldehyde in the presence of sodium hydroxide. This reaction results in the formation of 1BMN in high yield with few side reactions.
Formula:C16H15NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:285.29 g/mol(E)-2-(Benzyloxy)-1-methoxy-4-(2-nitrovinyl)benzene
CAS:(E)-2-(Benzyloxy)-1-methoxy-4-(2-nitrovinyl)benzeneFormula:C16H15NO4Purity:95%Molecular weight:285.29Benzene, 1-methoxy-4-(2-nitroethenyl)-2-(phenylmethoxy)-, (E)-
CAS:Purity:95%Molecular weight:285.2990112




