CymitQuimica logo

CAS 63909-29-5

:

trans-3-benzyloxy-4-methoxy-beta-nitro-styrene

Description:
Trans-3-benzyloxy-4-methoxy-beta-nitro-styrene is an organic compound characterized by its complex structure, which includes a styrene backbone with various substituents. The presence of a benzyloxy group and a methoxy group contributes to its unique chemical properties, such as increased lipophilicity and potential for engaging in various chemical reactions. The beta-nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structural features suggest potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the trans configuration of the double bond in the styrene moiety is significant, as it can affect the compound's stereochemistry and interactions with biological targets. Overall, trans-3-benzyloxy-4-methoxy-beta-nitro-styrene is a versatile compound with interesting chemical behavior, making it a subject of interest in various fields of research.
Formula:C16H15NO4
InChI:InChI=1/C16H15NO4/c1-20-15-8-7-13(9-10-17(18)19)11-16(15)21-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3/b10-9+
InChI key:JNMKPRLNICRRIV-MDZDMXLPSA-N
SMILES:COC1=C(C=C(C=C1)/C=C/[N+](=O)[O-])OCC2=CC=CC=C2
Synonyms:
  • trans-3-Benzyloxy-4-methoxy-beta-nitrostyrene
  • 2-(benzyloxy)-1-methoxy-4-[(E)-2-nitroethenyl]benzene
  • 3-Benzyloxy-4-Methoxy-Β-Nitrostyrene
  • Trans-3-Benzyloxy-4-Methoxy-Β-Nitrostyrene
  • (E)-1-Methoxy-4-(2-nitroethenyl)-2-(phenylmethoxy)benzene
Found 5 products.