CymitQuimica logo

CAS 639091-75-1

:

methyl 2-(tert-butoxycarbonylamino)pyridine-4-carboxylate

Description:
Methyl 2-(tert-butoxycarbonylamino)pyridine-4-carboxylate, identified by its CAS number 639091-75-1, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylate functional group, which contributes to its acidity and reactivity. The tert-butoxycarbonyl (Boc) group serves as a protective group for amines, enhancing the compound's stability and facilitating various synthetic transformations. The methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound is typically used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. Its solubility properties are influenced by the presence of both polar and nonpolar groups, making it suitable for various solvent systems. Overall, methyl 2-(tert-butoxycarbonylamino)pyridine-4-carboxylate is a versatile intermediate in chemical synthesis with applications in medicinal chemistry.
Formula:C12H16N2O4
InChI:InChI=1/C12H16N2O4/c1-12(2,3)18-11(16)14-9-7-8(5-6-13-9)10(15)17-4/h5-7H,1-4H3,(H,13,14,16)
InChI key:TZCLGBJFBGZAQO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1cc(ccn1)C(=O)OC)O
Synonyms:
  • Methyl 2-[(tert-butoxycarbonyl)amino]isonicotinate
Found 4 products.