CymitQuimica logo

CAS 6392-97-8

:

6-Benzothiazolamine,2-phenyl-

Description:
6-Benzothiazolamine, 2-phenyl- is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. This compound features an amine group, contributing to its potential as a nucleophilic site in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the phenyl group enhances its aromatic character and may influence its reactivity and interactions with other molecules. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Additionally, its properties may be influenced by factors such as pH, temperature, and the presence of other functional groups in a reaction mixture. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with exposure.
Formula:C13H10N2S
InChI:InChI=1S/C13H10N2S/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9/h1-8H,14H2
InChI key:KRLJYUSJAVJLTM-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)N
Synonyms:
  • Benzothiazole,6-amino-2-phenyl- (6CI,7CI,8CI)
  • 2-Phenyl-6-aminobenzothiazole
  • 6-Amino-2-phenylbenzothiazole
Found 4 products.