CAS 63987-19-9

4-[3-(hydroxymethyl)phenoxy]phenol

Description:

4-[3-(Hydroxymethyl)phenoxy]phenol, with the CAS number 63987-19-9, is an organic compound characterized by its phenolic structure. It features a hydroxymethyl group attached to a phenyl ring, which is further connected to another phenolic moiety through an ether linkage. This compound typically exhibits properties associated with phenols, such as being a solid at room temperature and having moderate solubility in organic solvents. Its hydroxymethyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential applications in materials science, pharmaceuticals, or as an antioxidant. The compound's reactivity can be influenced by the functional groups present, allowing for further derivatization. Overall, 4-[3-(hydroxymethyl)phenoxy]phenol is of interest in both academic research and industrial applications due to its unique structural features and potential utility in various chemical processes.

Formula: C₁₃H₁₂O₃

InChI: InChI=1/C13H12O3/c14-9-10-2-1-3-13(8-10)16-12-6-4-11(15)5-7-12/h1-8,14-15H,9H2

SMILES: c1cc(cc(c1)Oc1ccc(cc1)O)CO

4'-Hydroxy-3-phenoxybenzyl Alcohol

Controlled Product

CAS: 63987-19-9

Formula: C₁₃H₁₂O₃

Color and Shape: Neat

Molecular weight: 216.233

Ref: TR-H951235

4-[3-(Hydroxymethyl)phenoxy]phenol

CAS: 63987-19-9

Please enquire for more information about 4-[3-(Hydroxymethyl)phenoxy]phenol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₂O₃

Purity: Min. 95%

Molecular weight: 216.23 g/mol

Ref: 3D-NCA98719