CAS 63991-23-1
:1-hydroxy-1-(4-methoxyphenyl)propan-2-aminium chloride
Description:
1-Hydroxy-1-(4-methoxyphenyl)propan-2-aminium chloride, with the CAS number 63991-23-1, is a quaternary ammonium compound characterized by its structure, which includes a hydroxyl group and a methoxy-substituted phenyl group attached to a propan-2-aminium backbone. This compound typically exhibits properties associated with quaternary ammonium salts, such as being soluble in water and organic solvents, and it may possess surfactant properties. The presence of the hydroxyl group can contribute to its potential as a hydrogen bond donor, influencing its solubility and reactivity. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, which may play a role in its biological activity or interaction with other molecules. As with many quaternary ammonium compounds, it may also exhibit antimicrobial properties, making it of interest in various applications, including pharmaceuticals and materials science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H16ClNO2
InChI:InChI=1/C10H15NO2.ClH/c1-7(11)10(12)8-3-5-9(13-2)6-4-8;/h3-7,10,12H,11H2,1-2H3;1H
SMILES:CC(C(c1ccc(cc1)OC)O)N.Cl
Synonyms:- 2-Amino-1-(4-methoxyphenyl)propan-1-ol hydrochloride (1:1)
- Benzenemethanol, .alpha.- (1-aminoethyl)-4-methoxy-, hydrochloride
- Benzenemethanol, Alpha-(1-Aminoethyl)-4-Methoxy-, Hydrochloride (1:1)
- Benzyl alcohol, .alpha.-(1-aminoethyl)-4-methoxy-, hydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Amino-1-(4-methoxyphenyl)propan-1-ol Hydrochloride
CAS:Controlled ProductApplications 2-Amino-1-(4-methoxyphenyl)propan-1-ol Hydrochloride could be useful for preparing hallucinogens.
References Ohshita, T., & Ando, H.: Japan J. Toxicol. Environ. Health, 38, 571 (1992)Formula:C10H15NO2·HClColor and Shape:NeatMolecular weight:217.692-Amino-1-(4-methoxyphenyl)propan-1-ol hydrochloride
CAS:Controlled ProductVersatile small molecule scaffoldFormula:C10H16ClNO2Purity:Min. 95%Molecular weight:217.69 g/mol

