CymitQuimica logo

CAS 640292-02-0

:

5-(4-methylphenyl)isoxazole-3-carbaldehyde

Description:
5-(4-Methylphenyl)isoxazole-3-carbaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a 4-methylphenyl group, indicating the presence of a methyl substituent on a phenyl ring, which contributes to its hydrophobic characteristics. The aldehyde functional group (-CHO) at the 3-position of the isoxazole ring is significant for its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. The presence of the isoxazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests it may exhibit specific physical properties such as solubility in organic solvents and potential fluorescence, depending on the substituents and their arrangement. Overall, 5-(4-methylphenyl)isoxazole-3-carbaldehyde is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H9NO2
InChI:InChI=1/C11H9NO2/c1-8-2-4-9(5-3-8)11-6-10(7-13)12-14-11/h2-7H,1H3
InChI key:MYACDOUALUEBHR-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)c1cc(C=O)no1
Found 4 products.