CAS 6403-17-4
:L-Seryl-L-alanine
Description:
L-Seryl-L-alanine, with the CAS number 6403-17-4, is a dipeptide composed of the amino acids serine and alanine. It is characterized by its structure, which includes an amine group, a carboxylic acid group, and a side chain that contributes to its unique properties. This compound is typically found in a crystalline form and is soluble in water due to the presence of polar functional groups. L-Seryl-L-alanine plays a role in various biochemical processes and can be involved in protein synthesis and metabolism. Its properties may include a specific melting point and stability under certain pH conditions, making it relevant in both research and potential therapeutic applications. Additionally, like many peptides, it may exhibit biological activity, influencing cellular functions and signaling pathways. Overall, L-Seryl-L-alanine is an important compound in the study of biochemistry and molecular biology, contributing to our understanding of protein structure and function.
Formula:C6H12N2O4
InChI:InChI=1S/C6H12N2O4/c1-3(6(11)12)8-5(10)4(7)2-9/h3-4,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,4-/m0/s1
InChI key:InChIKey=SSJMZMUVNKEENT-IMJSIDKUSA-N
SMILES:C(N[C@H](C(O)=O)C)([C@H](CO)N)=O
Synonyms:- 111: PN: US20130123467 SEQID: 135 claimed protein
- 4: PN: WO03052099 PAGE: 83 claimed protein
- 6: PN: WO2014102101 SEQID: 306 claimed protein
- 6: PN: WO2014102104 SEQID: 105 claimed protein
- <span class="text-smallcaps">L</smallcap>-Alanine, <smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Alanine, N-<smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Seryl-<smallcap>L</span>-alanine
- Alanine, N-<span class="text-smallcaps">L</smallcap>-seryl-, <smallcap>L</span>-
- Alanine, N-<span class="text-smallcaps">L</span>-seryl-
- H-Ser-Ala-OH
- Serylalanine
- Alanine, N-L-seryl-
- L-Alanine, L-seryl-
- L-Seryl-L-alanine
- L-Alanine, N-L-seryl-
- Alanine, N-L-seryl-, L-
- L-Ser-L-Ala-OH
- ser-ala
- Ser-Ala-OH
- N-Serylalanine
- (S)-2-((S)-2-Amino-3-hydroxypropanamido)propanoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Ser-Ala-OH
CAS:Bachem ID: 4001058.
Formula:C6H12N2O4Purity:> 98%Color and Shape:White PowderMolecular weight:176.17(S)-2-((S)-2-Amino-3-hydroxypropanamido)propanoic acid
CAS:(S)-2-((S)-2-Amino-3-hydroxypropanamido)propanoic acidFormula:C6H12N2O4Purity:97%Molecular weight:176.17Ser-Ala-OH
CAS:Formula:C6H12N2O4Purity:97%Color and Shape:Liquid, No data available.Molecular weight:176.172Ser-Ala-OH
CAS:Ser-Ala-OH is a water-soluble chemical with a hydroxyl group. It is the amino acid Serine and L-Alanine, which has a benzyl group at the end of it. The benzyl group is an aromatic ring that contains six carbon atoms, one nitrogen atom, and one hydrogen atom. This chemical has shown to have physiological effects on streptococcus bacteria. It also has been shown to be resistant to penicillin antibiotics. Ser-Ala-OH binds to membrane phospholipids in target cells by an inorganic base that allows for uptake by passive diffusion. Ser-Ala-OH can be used as a target for drugs such as penicillin because it inhibits protein synthesis in these cells and prevents the production of proteins vital for cell division.Formula:C6H12N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:176.17 g/mol




