CymitQuimica logo

CAS 6404-26-8

:

na-T-boc-N-epsilon-acetyl-L-lysine

Description:
Na-T-Boc-N-epsilon-acetyl-L-lysine, with the CAS number 6404-26-8, is a derivative of the amino acid lysine, which is characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and an acetyl group on the epsilon amino group of lysine. This compound is typically used in peptide synthesis and biochemistry due to its ability to protect the amino group during chemical reactions, allowing for selective modifications of other functional groups. The presence of the acetyl group enhances its solubility and stability in various solvents, making it suitable for use in organic synthesis. Na-T-Boc-N-epsilon-acetyl-L-lysine is generally stable under standard laboratory conditions but may be sensitive to strong acids or bases, which can lead to the deprotection of the Boc group. Its molecular structure contributes to its role in facilitating the synthesis of peptides and proteins, particularly in the context of solid-phase peptide synthesis. Overall, this compound is valuable in research and pharmaceutical applications involving amino acids and peptides.
Formula:C13H24N2O5
InChI:InChI=1/C13H24N2O5/c1-9(16)14-8-6-5-7-10(11(17)18)15-12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H,14,16)(H,15,19)(H,17,18)/t10-/m0/s1
InChI key:IOKOUUAPSRCSNT-JTQLQIEISA-N
SMILES:CC(=NCCCC[C@@H](C(=O)O)N=C(O)OC(C)(C)C)O
Synonyms:
  • Boc-Lys(Ac)-OH
  • N~6~-acetyl-N~2~-(tert-butoxycarbonyl)-L-lysine
Found 6 products.