CymitQuimica logo

CAS 640768-72-5

:

Cyclobutanecarboxamide, N-methoxy-N-methyl-

Description:
Cyclobutanecarboxamide, N-methoxy-N-methyl- is a chemical compound characterized by its cyclic structure and functional groups. It features a cyclobutane ring, which is a four-membered carbon ring, contributing to its unique physical and chemical properties. The presence of the carboxamide functional group indicates that it contains a carbonyl group (C=O) bonded to a nitrogen atom, which is further substituted with both a methoxy group (-OCH3) and a methyl group (-CH3). This substitution pattern can influence the compound's polarity, solubility, and reactivity. Typically, compounds like this may exhibit moderate to high boiling points due to the presence of hydrogen bonding capabilities associated with the amide group. Additionally, the methoxy and methyl groups can enhance the compound's lipophilicity, potentially affecting its biological activity and interactions with other molecules. Overall, the structural features of Cyclobutanecarboxamide, N-methoxy-N-methyl- suggest it may have applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-8(10-2)7(9)6-4-3-5-6/h6H,3-5H2,1-2H3
InChI key:HKNFUJIVKFTWJB-UHFFFAOYSA-N
SMILES:CN(C(=O)C1CCC1)OC
Synonyms:
  • N-Methoxy-N-methyl-cyclobutanecarboxamide
Found 5 products.