CAS 64090-98-8
:H-.beta.-(3-Pyridyl)-Ala-OH
Description:
H-β-(3-Pyridyl)-Ala-OH, with the CAS number 64090-98-8, is a chemical compound characterized by its structure, which includes a pyridine ring and an alanine residue. This compound is typically classified as a peptide or amino acid derivative, featuring a β-pyridyl group that contributes to its unique properties. The presence of the pyridine moiety can influence its solubility, reactivity, and potential biological activity, making it of interest in medicinal chemistry and drug development. The alanine component provides a basic amino acid structure, which may play a role in interactions with biological targets. H-β-(3-Pyridyl)-Ala-OH may exhibit specific pharmacological effects, potentially acting as a ligand or modulator in various biochemical pathways. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to neuropharmacology or as a building block in the synthesis of more complex molecules. As with many compounds, safety and handling precautions should be observed due to potential biological activity.
Formula:C8H11ClN2O2
InChI:InChI=1/C8H10N2O2.ClH/c9-7(8(11)12)4-6-2-1-3-10-5-6;/h1-3,5,7H,4,9H2,(H,11,12);1H/t7-;/m0./s1
SMILES:c1cc(C[C@@H](C(=O)O)N)cnc1.Cl
Synonyms:- L-3-Pyridylalanine
- 3-(3-Pyridyl)-L-alanine
- L-3-(3-Pyridyl)-Alanine
- 3-pyridin-3-yl-L-alanine
- 3-pyridin-3-yl-D-alanine
- N-pyridin-3-yl-L-alanine
- H-3-Pal-OH・2HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(3-Pyridyl)-L-alanine, 98%
CAS:3-(3-Pyridyl)-L-alanine is a antimycobacterial cyclodepsipeptide. PyrA is used to activate other aromatic acids. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The originaFormula:C8H10N2O2Purity:98%Molecular weight:166.18Ref: IN-DA003CKT
1g63.00€5g158.00€10g207.00€25g663.00€100gTo inquire250gTo inquire100mg24.00€250mg28.00€(2S)-2-Amino-3-(pyridin-3-yl)propanoic acid
CAS:(2S)-2-Amino-3-(pyridin-3-yl)propanoic acidPurity:99%Color and Shape:Off-White PowderMolecular weight:166.18g/mol(S)-2-Amino-3-(pyridin-3-yl)propanoic acid
CAS:Formula:C8H10N2O2Purity:95%Color and Shape:SolidMolecular weight:166.183-(3-Pyridyl)-L-alanine
CAS:3-(3-Pyridyl)-L-alanine is a cytotoxic compound that inhibits the biosynthesis of peptide hormones and has been shown to be effective against prostate cancer cells. It acts by inhibiting the functioned of the synthase gene, which encodes for a synthetase enzyme necessary for peptidyl chain formation. 3-(3-Pyridyl)-L-alanine also binds to receptors on cells such as cyclodepsipeptide analogs and antibiotics. This drug has been shown to inhibit the growth of bacteria in vivo through its ability to bind to ribosomal enzymes.
Formula:C8H10N2O2·HClPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:202.64 g/molRef: 3D-FP37187
Discontinued product





