CAS 64114-19-8

2-methyl-3-pyrrolidin-2-ylpyridine

Description:

2-Methyl-3-pyrrolidin-2-ylpyridine, identified by its CAS number 64114-19-8, is a chemical compound that features a pyridine ring substituted with a pyrrolidine moiety. This compound is characterized by its nitrogen-containing heterocyclic structure, which contributes to its potential biological activity. The presence of both a methyl group and a pyrrolidine ring enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Typically, compounds of this nature may exhibit various interactions with biological targets, making them of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Additionally, its synthesis may involve standard organic reactions such as alkylation or cyclization. Overall, 2-methyl-3-pyrrolidin-2-ylpyridine represents a class of compounds that could have applications in pharmaceuticals, particularly in the development of agents targeting neurological or cognitive functions.

Formula: C₁₀H₁₄N₂

InChI: InChI=1/C10H14N2/c1-8-9(4-2-6-11-8)10-5-3-7-12-10/h2,4,6,10,12H,3,5,7H2,1H3

SMILES: Cc1c(cccn1)C1CCCN1

2-Methyl Nornicotine

CAS: 64114-19-8

Formula: C₁₀H₁₄N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 162.2316

Ref: IN-DA00EFBE

2-Methyl-3-(pyrrolidin-2-yl)pyridine

CAS: 64114-19-8

2-Methyl-3-(pyrrolidin-2-yl)pyridine

Purity: 95%

Molecular weight: 162.24g/mol

Ref: 54-OR1044984

2-Methyl-3-(pyrrolidin-2-yl)pyridine

CAS: 64114-19-8

Purity: 95+%

Molecular weight: 162.2359924

Ref: 10-F687161

2-Methyl Nornicotine

Controlled Product

CAS: 64114-19-8

Applications 2-Methyl Nornicotine is a Nicotine (N412420) analog.

Formula: C₁₀H₁₄N₂

Color and Shape: Neat

Molecular weight: 162.23

Ref: TR-M325828