CymitQuimica logo

CAS 64114-19-8

:

2-methyl-3-pyrrolidin-2-ylpyridine

Description:
2-Methyl-3-pyrrolidin-2-ylpyridine, identified by its CAS number 64114-19-8, is a chemical compound that features a pyridine ring substituted with a pyrrolidine moiety. This compound is characterized by its nitrogen-containing heterocyclic structure, which contributes to its potential biological activity. The presence of both a methyl group and a pyrrolidine ring enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Typically, compounds of this nature may exhibit various interactions with biological targets, making them of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Additionally, its synthesis may involve standard organic reactions such as alkylation or cyclization. Overall, 2-methyl-3-pyrrolidin-2-ylpyridine represents a class of compounds that could have applications in pharmaceuticals, particularly in the development of agents targeting neurological or cognitive functions.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c1-8-9(4-2-6-11-8)10-5-3-7-12-10/h2,4,6,10,12H,3,5,7H2,1H3
InChI key:PNNMNLLCHYHPBH-UHFFFAOYSA-N
SMILES:Cc1c(cccn1)C1CCCN1
Found 4 products.