CymitQuimica logo

CAS 64118-44-1

:

Tridecanoic-2,2-d2 acid(9CI)

Description:
Tridecanoic-2,2-d2 acid, also known as tridecanoic acid-d2, is a deuterated fatty acid with the molecular formula C13H26O2. It is a straight-chain saturated fatty acid, characterized by a long hydrophobic hydrocarbon tail and a carboxylic acid functional group. The presence of deuterium (d2) indicates that two hydrogen atoms in the molecule are replaced with deuterium isotopes, which can be useful in various analytical applications, including nuclear magnetic resonance (NMR) spectroscopy and tracer studies. Tridecanoic acid itself is typically found in animal fats and some plant oils, and it is known for its potential applications in the food industry, cosmetics, and as a surfactant. The compound is generally considered to be non-toxic and biodegradable, making it suitable for various industrial applications. Its physical properties, such as melting point and solubility, may vary slightly due to the isotopic substitution, but it retains the characteristics typical of fatty acids, including hydrophobicity and the ability to form emulsions.
Formula:C13H24D2O2
InChI:InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i12D2
InChI key:SZHOJFHSIKHZHA-XUWBISKJSA-N
SMILES:[2H]C([2H])(CCCCCCCCCCC)C(=O)O
Synonyms:
  • 2,2-Dideuterotridecanoic Acid
  • Tridecanoic-2,2-D2 Acid
  • Tridecanoic-D Acid
Found 4 products.