CymitQuimica logo

CAS 64191-06-6

:

Benzoic acid,4-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 2,5-dioxo-1-pyrrolidinyl ester

Description:
Benzoic acid, 4-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 2,5-dioxo-1-pyrrolidinyl ester, with CAS number 64191-06-6, is a chemical compound characterized by its complex structure that includes both benzoic acid and pyrrolidine moieties. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as an intermediate in organic synthesis due to its functional groups. The presence of the pyrrolidine ring suggests potential biological activity, as many compounds containing this structure are known for their pharmacological properties. Additionally, the ester functional group may impart specific reactivity, making it useful in various chemical reactions. Overall, this compound's unique structural features contribute to its potential utility in diverse chemical and biological contexts.
Formula:C15H10N2O6
InChI:InChI=1S/C15H10N2O6/c18-11-5-6-12(19)16(11)10-3-1-9(2-4-10)15(22)23-17-13(20)7-8-14(17)21/h1-6H,7-8H2
InChI key:GSYZMVGSEGJHGT-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)N3C(=O)C=CC3=O
Synonyms:
  • 1H-Pyrrole-2,5-dione,1-[4-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]phenyl]- (9CI)
  • p-Maleimidobenzoic acid N-hydroxysuccinimide ester
Found 6 products.