CAS 64395-76-2
:(3aR,4aR,8aR,9aR)-5,8a-dimethyl-3-methylidene-3a,4,4a,7,8,8a,9,9a-octahydronaphtho[2,3-b]furan-2(3H)-one
Description:
The chemical substance with the name "(3aR,4aR,8aR,9aR)-5,8a-dimethyl-3-methylidene-3a,4,4a,7,8,8a,9,9a-octahydronaphtho[2,3-b]furan-2(3H)-one" and CAS number "64395-76-2" is a complex organic compound characterized by its unique bicyclic structure, which includes a fused naphthalene and furan moiety. This compound features multiple chiral centers, contributing to its stereochemical complexity. The presence of methyl and methylidene groups indicates potential sites for reactivity and influence on its physical properties, such as boiling and melting points. The octahydronaphtho structure suggests that it may exhibit hydrophobic characteristics, making it less soluble in polar solvents. Additionally, the compound may possess biological activity, which could be of interest in medicinal chemistry or natural product research. Its specific applications and interactions would depend on further studies, including its reactivity, stability, and potential uses in various chemical or pharmaceutical contexts.
Formula:C15H20O2
InChI:InChI=1/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h5,11-13H,2,4,6-8H2,1,3H3/t11-,12+,13-,15-/m1/s1
Synonyms:- iso-allo-Alantolactone
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Isoalloalantolactone - Inula helenium (elecampane)
CAS:Isoalloalantolactone is a sesquiterpene lactone, which is a type of naturally occurring organic compound. It is derived from the roots of Inula helenium, commonly known as elecampane. This plant source is known for its historical use in traditional medicine, often utilized for its purported health benefits.
Formula:C15H20O2Purity:Min. 95%Molecular weight:232.32 g/mol
