CAS 64465-53-8
:4-Fluoro-3-methoxyaniline
Description:
4-Fluoro-3-methoxyaniline, with the CAS number 64465-53-8, is an organic compound that belongs to the class of anilines, which are aromatic amines. This compound features a fluorine atom and a methoxy group (-OCH3) attached to a benzene ring, specifically at the para and meta positions relative to the amino group (-NH2), respectively. It is typically a solid at room temperature and may exhibit a pale yellow to light brown color. The presence of the fluorine atom can influence its reactivity and solubility, often enhancing its lipophilicity compared to non-fluorinated analogs. 4-Fluoro-3-methoxyaniline is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Additionally, it may exhibit specific biological activities, making it a subject of research in medicinal chemistry. Proper handling and safety measures are essential, as with many aniline derivatives, due to potential toxicity and environmental concerns.
Formula:C8H10FNO
InChI:InChI=1/C8H10FNO/c1-11-8-4-6(5-10)2-3-7(8)9/h2-4H,5,10H2,1H3
SMILES:COc1cc(ccc1F)CN
Synonyms:- 3-Methoxy-4-Fluoroaniline
- (4-Fluoro-3-Methoxy-Phenyl)Methanamine
- 5-Amino-2-fluoroanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-3-methoxyaniline
CAS:4-Fluoro-3-methoxyanilineFormula:C7H8FNOPurity:≥95%Color and Shape:Brown SolidMolecular weight:141.14292Benzenamine, 4-fluoro-3-methoxy-
CAS:Formula:C7H8FNOPurity:98%Color and Shape:SolidMolecular weight:141.14294-Fluoro-3-methoxyaniline
CAS:Formula:C7H8FNOPurity:>98.0%(GC)(T)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:141.154-Fluoro-3-methoxyaniline
CAS:4-Fluoro-3-methoxyaniline is a high quality reagent with a CAS number of 64465-53-8. It is an intermediate in the synthesis of other complex compounds, such as chroman derivatives. This compound can be used as a building block for the synthesis of organic compounds and also has many medicinal applications. 4-Fluoro-3-methoxyaniline is soluble in most solvents and can be stored at room temperature.Formula:C7H8FNOPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:141.14 g/mol




