CAS 64550-71-6
:methyl 2,3,4,6-tetra-O-acetyl-A-D-*thiomannopyran
Description:
Methyl 2,3,4,6-tetra-O-acetyl-α-D-thiomannopyran is a synthetic derivative of thiomannose, characterized by the presence of four acetyl groups attached to the hydroxyl groups of the sugar moiety. This compound features a pyranose ring structure, which is typical of many carbohydrates, and the thiol group replaces the oxygen in the ring, imparting unique chemical properties. The acetylation enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions and applications. It is often employed in glycosylation reactions and as an intermediate in the synthesis of more complex carbohydrates or glycosides. The presence of the thiol group can also influence reactivity, allowing for potential applications in medicinal chemistry and biochemistry. As with many acetylated sugars, this compound may exhibit different physical properties, such as melting point and solubility, compared to its non-acetylated counterparts. Proper handling and storage are essential due to the potential reactivity of the thiol group and the presence of acetyl groups.
Formula:C15H22O9S
InChI:InChI=1/C15H22O9S/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3
SMILES:CC(=O)OCC1C(C(C(C(O1)SC)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- methyl 2,3,4,6-tetra-O-acetyl-1-thiohexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside
CAS:Formula:C15H22O9SPurity:95%Color and Shape:SolidMolecular weight:378.3948(2R,3R,4S,5S,6R)-2-(Acetoxymethyl)-6-(Methylthio)Tetrahydro-2H-Pyran-3,4,5-Triyl Triacetate
CAS:(2R,3R,4S,5S,6R)-2-(Acetoxymethyl)-6-(Methylthio)Tetrahydro-2H-Pyran-3,4,5-Triyl TriacetatePurity:98%Molecular weight:378.39g/molMethyl 2,3,4,6-Tetra-O-acetyl-1-thio-α-D-mannopyranoside (contains ca. 5% β-isomer)
CAS:Formula:C15H22O9SPurity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:378.39Methyl 2,3,4,6-tetra-O-acetyl-α-D-thiomannopyranoside
CAS:Methyl 2,3,4,6-tetra-O-acetyl-a-D-thiomannopyranoside is a linker that is used in the synthesis of oligodeoxyribonucleotides. This compound has been shown to inhibit the expression of factor receptor α subunit in plant cells. In human studies, methyl 2,3,4,6-tetra-O-acetyl-a-D-thiomannopyranoside has been found to be effective against infectious diseases such as HIV and malaria by suppressing the production of growth factors. It also inhibits protein synthesis and cell division. Methyl 2,3,4,6-tetra-O-acetyl-a -D -thiomannopyranoside is synthesized from D -mannose and acetaldehyde in plants. The biosynthesis of this compound occurs by means of a sequence that begins with phosphorylation of D -mannoseFormula:C15H22O9SPurity:Min. 95%Molecular weight:378.4 g/mol




