CymitQuimica logo

CAS 64550-71-6

:

methyl 2,3,4,6-tetra-O-acetyl-A-D-*thiomannopyran

Description:
Methyl 2,3,4,6-tetra-O-acetyl-α-D-thiomannopyran is a synthetic derivative of thiomannose, characterized by the presence of four acetyl groups attached to the hydroxyl groups of the sugar moiety. This compound features a pyranose ring structure, which is typical of many carbohydrates, and the thiol group replaces the oxygen in the ring, imparting unique chemical properties. The acetylation enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions and applications. It is often employed in glycosylation reactions and as an intermediate in the synthesis of more complex carbohydrates or glycosides. The presence of the thiol group can also influence reactivity, allowing for potential applications in medicinal chemistry and biochemistry. As with many acetylated sugars, this compound may exhibit different physical properties, such as melting point and solubility, compared to its non-acetylated counterparts. Proper handling and storage are essential due to the potential reactivity of the thiol group and the presence of acetyl groups.
Formula:C15H22O9S
InChI:InChI=1/C15H22O9S/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3
InChI key:XWFUCHLBRWBKGN-NIFZNCRKSA-N
SMILES:CC(=O)OCC1C(C(C(C(O1)SC)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:
  • methyl 2,3,4,6-tetra-O-acetyl-1-thiohexopyranoside
Found 6 products.