CAS 64657-21-2
:Isoforskolin
Description:
Isoforskolin, with the CAS number 64657-21-2, is a chemical compound derived from the plant Coleus forskohlii, which is known for its traditional use in herbal medicine. It is a labdane diterpenoid, characterized by its unique bicyclic structure that includes a fused cyclopentane and cyclohexane ring system. Isoforskolin exhibits various biological activities, including potential anti-inflammatory, anti-cancer, and cardiovascular effects, making it a subject of interest in pharmacological research. The compound is known to activate adenylate cyclase, leading to increased levels of cyclic AMP (cAMP) in cells, which plays a crucial role in various signaling pathways. Isoforskolin is typically studied for its therapeutic potential, particularly in metabolic disorders and weight management. Its solubility properties can vary, and it is often analyzed using techniques such as chromatography. As with many natural compounds, further research is necessary to fully understand its mechanisms of action and potential applications in medicine.
Formula:C22H34O7
InChI:InChI=1S/C22H34O7/c1-8-19(5)11-14(25)22(27)20(6)13(24)9-10-18(3,4)16(20)15(28-12(2)23)17(26)21(22,7)29-19/h8,13,15-17,24,26-27H,1,9-11H2,2-7H3/t13-,15-,16-,17-,19-,20-,21+,22-/m0/s1
InChI key:InChIKey=CLOQVZCSBYBUPB-KGGHGJDLSA-N
SMILES:C[C@@]12[C@]3(O)[C@@](C)([C@@H](O)[C@@H](OC(C)=O)[C@]1(C(C)(C)CC[C@@H]2O)[H])O[C@](C=C)(C)CC3=O
Synonyms:- (1α,5α,6β,7β)-6-(Acetyloxy)-8,13-epoxy-1,7,9-trihydroxylabd-14-en-11-one
- (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-(Acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-1-one
- 1H-Naphtho[2,1-b]pyran-1-one, 6-(acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-, (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-
- 1H-Naphtho[2,1-b]pyran-1-one, 6-(acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-, [3R-(3α,4aβ,5β,6β,6aα,10α,10aβ,10bα)]-
- 6β-ACETOXY-8,13-EPOXY-1α,7β,9α-TRIHYDROXY-LABD-14-EN-11-ONE
- 6β-Acetoxy-8,13-epoxy-1α,7β,9α-trihydroxylabd-14-en-11-one
- Coleonol B
- Excolabdone C
- Isoforskolin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Isoforskolin
CAS:Isoforskolin, from Coleus forskohlii, lowers TNF-α, IL-1β, IL-6, IL-8; studied for Lyme arthritis treatment.Formula:C22H34O7Purity:99.87%Color and Shape:White SolidMolecular weight:410.5012(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5,10,10b-Trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-3-vinyldodecahydro-1H-benzo[f]chromen-6-yl acetate
CAS:Formula:C22H34O7Purity:98%Color and Shape:SolidMolecular weight:410.5012Isoforskolin (Standard)
CAS:Isoforskolin (Standard) is a reference standard for research and analysis in studies involving Isoforskolin. Isoforskolin is derived from Coleus forskohlii and reduces the secretion of TNF-α, IL-1β, IL-6 and IL-8 in human mononuclear leukocytes. Isoforskolin can be used in studies about the treatment of Lyme arthritis.Formula:C22H34O7Molecular weight:410.5012Isoforskolin
CAS:Oxygen-heterocyclic compoundFormula:C22H34O7Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:410.51Isoforskolin
CAS:Isoforskolin is a forskolin derivative diterpenoid, which is extracted from the roots of *Coleus forskohlii*. This bioactive compound acts primarily by stimulating adenylate cyclase activity, leading to increased levels of cyclic adenosine monophosphate (cAMP) within cells. The elevated cAMP serves as a secondary messenger that can modulate various physiological responses, including lipolysis and vasodilation.Formula:C22H34O7Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:410.5 g/mol









