CymitQuimica logo

CAS 64661-12-7

:

Ethanone,2,2-dichloro-1-(hexahydro-1H-azepin-1-yl)-

Description:
Ethanone, 2,2-dichloro-1-(hexahydro-1H-azepin-1-yl)-, also known by its CAS number 64661-12-7, is a chemical compound characterized by its unique structure, which includes a dichloro substituent and a hexahydroazepine moiety. This compound typically exhibits properties associated with both ketones and amines due to the presence of the ethanone and azepine functional groups. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The dichloro groups contribute to its reactivity, potentially making it useful in various chemical syntheses or as an intermediate in organic chemistry. Additionally, the azepine ring may impart certain biological activities, making this compound of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, the compound's characteristics suggest potential applications in both industrial and research settings, particularly in the development of new materials or pharmaceuticals.
Formula:C8H13Cl2NO
InChI:InChI=1S/C8H13Cl2NO/c9-7(10)8(12)11-5-3-1-2-4-6-11/h7H,1-6H2
InChI key:LPVPNRSVMLNXGQ-UHFFFAOYSA-N
SMILES:C1CCCN(CC1)C(=O)C(Cl)Cl
Synonyms:
  • N-(Dichloroacetyl)hexamethyleneimide
  • TI 35
  • 1H-Azepine,1-(dichloroacetyl)hexahydro- (9CI)
Found 1 products.