CAS 64670-94-6
:1-Benzopyrylium, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, chloride (1:1)
Description:
1-Benzopyrylium, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, chloride (1:1), with CAS number 64670-94-6, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a benzopyrylium core. This compound features multiple hydroxyl groups, which contribute to its solubility and reactivity, as well as a methoxy group that can influence its electronic properties and stability. The presence of the chloride ion indicates that it exists as a salt, which can affect its physical properties, such as melting point and solubility in various solvents. The compound is likely to exhibit interesting optical properties due to its conjugated system, making it potentially useful in applications such as dyes or pigments. Additionally, the hydroxyl groups may impart antioxidant properties, suggesting potential biological activity. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic chemistry and materials science.
Formula:C16H13O5·Cl
InChI:InChI=1S/C16H12O5.ClH/c1-20-15-4-2-9(6-13(15)19)14-5-3-11-12(18)7-10(17)8-16(11)21-14;/h2-8H,1H3,(H2-,17,18,19);1H
InChI key:InChIKey=OXTYCUBGMFGOAX-UHFFFAOYSA-N
SMILES:OC=1C2=C([O+]=C(C=C2)C3=CC(O)=C(OC)C=C3)C=C(O)C1.[Cl-]
Synonyms:- 1-Benzopyrylium, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, chloride
- 1-Benzopyrylium, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, chloride (1:1)
- 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromeniumchlorid
- Diosmetinidin
- Diosmetinidin chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Diosmetinidin chloride
CAS:Diosmetinidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H13O5ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:320.71DIOSMETINIDIN CHLORIDE
CAS:DIOSMETINIDIN CHLORIDEFormula:C16H13ClO5Purity:≥97%Molecular weight:320.72Diosmetinidin chloride
CAS:Diosmetinidin chloride is a fine chemical that can be used as a versatile building block for the synthesis of complex compounds. Diosmetinidin chloride has been shown to have useful scaffolding properties and is useful as a reaction component in research chemicals and speciality chemicals. It reacts with alcohols, phenols, amines, thiols, sulfides, and carboxylic acid derivatives to form new compounds. This compound is also used as a reagent in organic synthesis.Formula:C16H13ClO5Purity:Min. 95%Color and Shape:PowderMolecular weight:320.72 g/molDiosmetinidin Chloride
CAS:Controlled ProductFormula:C16H13O5·ClColor and Shape:NeatMolecular weight:320.72




