CymitQuimica logo

CAS 64714-79-0

:

Pentanoic acid, 3-oxo-5-(phenylmethoxy)-, ethyl ester

Description:
Pentanoic acid, 3-oxo-5-(phenylmethoxy)-, ethyl ester, identified by its CAS number 64714-79-0, is an organic compound characterized by its ester functional group, which is derived from pentanoic acid and an ethyl alcohol moiety. This compound features a phenylmethoxy group, contributing to its aromatic characteristics and potentially influencing its reactivity and solubility. The presence of the keto group (3-oxo) indicates that it has a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Typically, esters like this compound are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis due to the presence of multiple functional groups that can undergo further chemical transformations. Overall, the compound's unique combination of functional groups makes it a versatile substance in both industrial and research settings.
Formula:C14H18O4
InChI:InChI=1S/C14H18O4/c1-2-18-14(16)10-13(15)8-9-17-11-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3
InChI key:XXYYVXDQSFMEPX-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(=O)CCOCC1=CC=CC=C1
Synonyms:
  • ethyl 5-(benzyloxy)-3-oxopentanoate
  • Pentanoic acid, 3-oxo-5-(phenylmethoxy)-, ethyl ester
Found 4 products.