CymitQuimica logo

CAS 64746-04-9

:

1,4-Benzenedicarbonitrile,2,5-bis(bromomethyl)-

Description:
1,4-Benzenedicarbonitrile, 2,5-bis(bromomethyl)-, also known by its CAS number 64746-04-9, is an organic compound characterized by its structure, which features a benzene ring with two cyano (nitrile) groups and two bromomethyl substituents. This compound is typically a solid at room temperature and may exhibit a crystalline form. The presence of the cyano groups imparts significant polarity and potential reactivity, making it useful in various chemical syntheses and applications. The bromomethyl groups can serve as reactive sites for further chemical modifications, allowing for the introduction of additional functional groups. This compound may be utilized in the synthesis of polymers, pharmaceuticals, or as an intermediate in organic reactions. Its properties, such as solubility and melting point, can vary depending on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine and nitrile functionalities.
Formula:C10H6Br2N2
InChI:InChI=1S/C10H6Br2N2/c11-3-7-1-9(5-13)8(4-12)2-10(7)6-14/h1-2H,3-4H2
InChI key:IBVXNROAOGBZRW-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1C#N)CBr)C#N)CBr
Synonyms:
  • 2,5-Bis(bromomethyl)-1,4-dicyanobenzene
Found 5 products.