CymitQuimica logo

CAS 648-42-0

:

1,1,1,2,2,3,3-heptafluoro-4-(prop-2-en-1-yloxy)butane

Description:
1,1,1,2,2,3,3-Heptafluoro-4-(prop-2-en-1-yloxy)butane, with CAS number 648-42-0, is a fluorinated organic compound characterized by its unique structure that includes a butane backbone substituted with multiple fluorine atoms and an allyloxy group. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and low reactivity, making it useful in various applications, including as a refrigerant or in specialty chemical formulations. The presence of the prop-2-en-1-yloxy group introduces a reactive site that can participate in further chemical reactions, such as polymerization. Additionally, the fluorinated nature of the compound contributes to its low surface tension and high thermal stability, which are advantageous in certain industrial processes. Its physical properties, such as boiling point and solubility, are influenced by the fluorinated groups, typically resulting in low volatility and limited miscibility with water. Overall, this compound exemplifies the unique characteristics of fluorinated organic substances, combining stability with potential reactivity due to its functional groups.
Formula:C7H7F7O
InChI:InChI=1/C7H7F7O/c1-2-3-15-4-5(8,9)6(10,11)7(12,13)14/h2H,1,3-4H2
InChI key:OLXJWIOOAUUDHX-UHFFFAOYSA-N
SMILES:C=CCOCC(C(C(F)(F)F)(F)F)(F)F
Synonyms:
  • 4-(Allyloxy)-1,1,1,2,2,3,3-heptafluorobutane
  • Allyl 2,2,3,3,4,4,4-heptafluorobutyl ether
  • Butane, 1,1,1,2,2,3,3-Heptafluoro-4-(2-Propen-1-Yloxy)-
Found 2 products.