CAS 64833-96-1

Butanoic-3,3-d2 acid(9CI)

Description:

Butanoic-3,3-d2 acid, also known as 3,3-deuterobutanoic acid, is a deuterated form of butanoic acid, which is a four-carbon straight-chain carboxylic acid. The presence of deuterium (D or ²H) at the 3-position of the butanoic acid molecule alters its physical and chemical properties slightly compared to its non-deuterated counterpart. This compound is typically used in research and analytical chemistry, particularly in studies involving isotopic labeling, NMR spectroscopy, and metabolic tracing. It retains the characteristic properties of butanoic acid, such as being a colorless liquid with a pungent odor, and it is soluble in water and organic solvents. The deuteration can influence reaction kinetics and mechanisms, making it valuable in various scientific applications. As with other carboxylic acids, it can participate in typical acid-base reactions and can be converted into various derivatives. Safety precautions should be observed when handling this compound, as it may cause irritation to skin and eyes.

Formula: C₄H₆D₂O₂

InChI: InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/i2D2

InChI key: FERIUCNNQQJTOY-CBTSVUPCSA-N

SMILES: [2H]C([2H])(C)CC(=O)O

Synonyms:

• Butyric-3,3-D2 Acid

Butyric-3,3-d2 Acid

CAS: 107-92-6, 64833-96-1

Formula: CH₃CD₂CH₂COOH

Purity: 98 atom % D

Color and Shape: Colourless Liquid

Molecular weight: 90.06498

Ref: 3U-D1203

Butyric-3,3-d2 Acid

CAS: 64833-96-1

Formula: C₄H₈O₂

Molecular weight: 90.12

Ref: BE-MD-6016D2

Butyric-3,3-d2 Acid

Controlled Product

CAS: 64833-96-1

Applications Butyric-3,3-d2 Acid (CAS# 64833-96-1) is a useful isotopically labeled research compound.

Formula: C₄H₆D₂O₂

Color and Shape: Neat

Molecular weight: 90.12

Ref: TR-B692239