CymitQuimica logo

CAS 648906-27-8

:

1,3,2-Dioxaborolane,2-[4-(cyclopropylsulfonyl)phenyl]-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-[4-(cyclopropylsulfonyl)phenyl]-4,4,5,5-tetramethyl- is an organoboron compound characterized by its dioxaborolane ring structure, which features a boron atom bonded to two oxygen atoms in a five-membered cyclic arrangement. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing pharmaceuticals. The presence of the cyclopropylsulfonyl group enhances its reactivity and may influence its biological activity. The tetramethyl substitution contributes to the compound's stability and solubility properties. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of polar functional groups, which can affect their interactions in biological systems. Additionally, the unique structural features may allow for specific interactions with biological targets, making it a subject of interest in drug discovery. As with many organoboron compounds, it may also participate in various chemical reactions, including cross-coupling reactions, which are valuable in synthetic organic chemistry.
Formula:C15H21BO4S
InChI:InChI=1S/C15H21BO4S/c1-14(2)15(3,4)20-16(19-14)11-5-7-12(8-6-11)21(17,18)13-9-10-13/h5-8,13H,9-10H2,1-4H3
InChI key:XSIXMQWYBMTLMS-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)C3CC3
Found 5 products.