CAS 64913-16-2
:1,2,3,4-tetra-O-acetyl-A-L-(-)-fucose
Description:
1,2,3,4-Tetra-O-acetyl-A-L-(-)-fucose is a derivative of fucose, a naturally occurring deoxy sugar. This compound is characterized by the presence of four acetyl groups attached to the hydroxyl groups of the fucose molecule, which enhances its stability and solubility in organic solvents. The acetylation modifies the reactivity of the hydroxyl groups, making it useful in various synthetic applications, particularly in glycosylation reactions. The stereochemistry of this compound is significant, as it is the L-(-) enantiomer, which can influence its biological activity and interactions with other biomolecules. Typically, this compound appears as a white to off-white crystalline solid and is soluble in organic solvents like dichloromethane and methanol. Its applications extend to carbohydrate chemistry, where it serves as an intermediate in the synthesis of more complex glycosides and oligosaccharides. Additionally, due to its structural features, it may exhibit specific interactions in biological systems, making it of interest in medicinal chemistry and biochemistry research.
Formula:C14H20O9
InChI:InChI=1/C14H20O9/c1-6-11(20-7(2)15)12(21-8(3)16)13(22-9(4)17)14(19-6)23-10(5)18/h6,11-14H,1-5H3/t6-,11?,12-,13-,14-/m0/s1
SMILES:C[C@H]1C([C@@H]([C@@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,3,4-Tetra-O-acetyl-α-L-fucopyranose
CAS:Formula:C14H20O9Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:332.31(2S,3S,4R,5R,6S)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate
CAS:Formula:C14H20O9Purity:98%Color and Shape:SolidMolecular weight:332.30321,2,3,4-Tetra-O-acetyl-α-L-fucopyranose
CAS:1,2,3,4-Tetra-O-acetyl-α-L-fucopyranoseFormula:C14H20O9Purity:>98.0%Molecular weight:332.303191,2,3,4-Tetra-O-acetyl-α-L-fucopyranose
CAS:1,2,3,4-Tetra-O-acetyl-α-L-fucopyranose is a chiral compound and it has been used as a biocatalyst in the industrial production of L-amino acids. The enantiomers are obtained by enzymatic hydrolysis of the racemic mixture with lipases. It has been shown that 1,2,3,4-Tetra-O-acetyl-α-L-fucopyranose is an enantioselective substrate for lipolytic enzymes. Lipolytic enzymes are also screened for lipase activity using this compound as a surrogate.Formula:C14H20O9Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:332.3 g/mol1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose
CAS:Controlled ProductFormula:C14H20O9Color and Shape:NeatMolecular weight:332.3





