CAS 64917-82-4
:Schisantherin D
Description:
Schisantherin D, with the CAS number 64917-82-4, is a natural compound primarily derived from the plant Schisandra chinensis, which is known for its medicinal properties. This compound belongs to the class of lignans, characterized by their phenolic structure and potential health benefits. Schisantherin D exhibits various biological activities, including antioxidant, anti-inflammatory, and hepatoprotective effects, making it of interest in pharmacological research. Its chemical structure features multiple hydroxyl groups, contributing to its reactivity and interaction with biological systems. Additionally, Schisantherin D has been studied for its potential role in enhancing cognitive function and protecting against neurodegenerative diseases. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and therapeutic applications. Overall, Schisantherin D represents a promising area of study in natural product chemistry and its implications for health and wellness.
Formula:C29H28O9
InChI:InChI=1S/C29H28O9/c1-15-10-17-11-19-23(36-13-34-19)25(32-3)21(17)22-18(12-20-24(26(22)33-4)37-14-35-20)27(29(15,2)31)38-28(30)16-8-6-5-7-9-16/h5-9,11-12,15,27,31H,10,13-14H2,1-4H3
InChI key:InChIKey=PGEJVRVFUGSAJF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC4=C(C3OC)OCO4)CC(C)C(C)(O)C(OC(=O)C5=CC=CC=C5)C2=CC6=C1OCO6
Synonyms:- (-)-Schisantherin D
- (5R,6S,7S)-6-Hydroxy-13,14-dimethoxy-6,7-dimethyl-5,6,7,8-tetrahydro[1,3]benzodioxolo[5',6':3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl benzoate
- 1,3-benzodioxolo[5',6':3,4]cycloocta[1,2-f][1,3]benzodioxole-5,6-diol, 5,6,7,8-tetrahydro-13,14-dimethoxy-6,7-dimethyl-, 5-benzoate, (5R,6S,7S)-
- Cycloocta[1,2-f:3,4-f′]bis[1,3]benzodioxole-5,6-diol, 5,6,7,8-tetrahydro-13,14-dimethoxy-6,7-dimethyl-, 5-benzoate, (5S,6S,7S,13aS)-
- Cycloocta[1,2-f:3,4-f′]bis[1,3]benzodioxole-5,6-diol, 5,6,7,8-tetrahydro-13,14-dimethoxy-6,7-dimethyl-, 5-benzoate, stereoisomer
- Schizantherin D
- Shisantherin D
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Schisantherin D
CAS:Schisantherin D shows good anti-HIV activity with the EC50 value of 0.5 micrograms/mL, and the therapeutic index (TI) value of 110.Formula:C29H28O9Purity:98%Color and Shape:SolidMolecular weight:520.534Schisantherin D
CAS:Schisantherin D is a lignan compound, which is a secondary metabolite derived from the fruit of the Schisandra chinensis plant. This compound is noteworthy due to its origin from a traditional medicinal plant widely utilized in Eastern medicine. As a bioactive lignan, Schisantherin D displays a multifaceted mode of action, primarily involving the modulation of cellular signaling pathways. It is known to exert its effects by influencing activities of enzymes such as protein kinases, and by interacting with receptor-mediated pathways, thereby exhibiting neuroprotective and anti-inflammatory effects.Formula:C29H28O9Purity:Min. 95%Molecular weight:520.5 g/mol


