CymitQuimica logo

CAS 65019-14-9

:

2-Furancarboxaldehyde,3-nitro-

Description:
2-Furancarboxaldehyde, 3-nitro- is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxaldehyde functional group (-CHO) and a nitro group (-NO2) attached to the furan ring, specifically at the 2 and 3 positions, respectively. It is typically a yellow to brown liquid or solid, depending on its purity and form. The presence of the nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. This compound is of interest in organic synthesis and may have applications in the development of pharmaceuticals or agrochemicals. Additionally, its unique structure can influence its physical properties, such as solubility and boiling point, making it a subject of study in both synthetic and applied chemistry. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C5H3NO4
InChI:InChI=1S/C5H3NO4/c7-3-5-4(6(8)9)1-2-10-5/h1-3H
InChI key:XPEJRQSXLRKGBZ-UHFFFAOYSA-N
SMILES:C1=COC(=C1[N+](=O)[O-])C=O
Synonyms:
  • 3-Nitrofurfural
Found 2 products.