CAS 65039-10-3
:1-Allyl-3-methylimidazolium chloride
Description:
1-Allyl-3-methylimidazolium chloride is an ionic liquid, characterized by its low volatility and high thermal stability. It features a cation derived from imidazole, specifically with an allyl group and a methyl group at the 1 and 3 positions, respectively, which contributes to its unique properties. The chloride anion complements the cation, enhancing its solubility in various solvents and its ability to dissolve a wide range of organic and inorganic materials. This ionic liquid exhibits a relatively low melting point, making it liquid at room temperature, and it is known for its good electrochemical stability. Additionally, 1-Allyl-3-methylimidazolium chloride is often utilized in applications such as catalysis, extraction processes, and as a solvent in organic synthesis due to its tunable properties and ability to facilitate reactions. Its environmental impact is generally considered lower than that of traditional organic solvents, making it a subject of interest in green chemistry initiatives.
Formula:C7H11ClN2
InChI:InChI=1/C7H11N2.ClH/c1-3-4-9-6-5-8(2)7-9;/h3,5-7H,1,4H2,2H3;1H/q+1;/p-1
Synonyms:- 1H-imidazolium, 1-methyl-3-(2-propen-1-yl)-, chloride (1:1)
- 1-methyl-3-(prop-2-en-1-yl)-1H-imidazol-3-ium chloride
- 3-methyl-1-(prop-2-en-1-yl)-1H-imidazol-3-ium chloride
- 1-Allyl-Methylimidazolium Chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Allyl-3-methylimidazolium Chloride
CAS:Formula:C7H11ClN2Purity:>98.0%(T)(HPLC)Color and Shape:White or Colorless to Yellow to Orange powder to lump to clear liquidMolecular weight:158.631-Allyl-3-methylimidazolium chloride, 98%
CAS:1-Allyl-3-methylimidazolium chloride is used as an ionic liquid as well as nonderivatizing solvent for cellulose. It acts as a plasticizer for cornstarch and finds application as a solid biopolymer electrolyte. Further, it plays an important role in the preparation of reducing sugar. This Thermo SFormula:C7H11ClN2Purity:98%Color and Shape:White to cream to yellow to pale brown, Crystalline or fused solid or crystals or powder or lumps or crystalline powderMolecular weight:158.631-Allyl-3-methyl-1H-imidazol-3-ium chloride
CAS:Formula:C7H11ClN2Purity:98%Color and Shape:LiquidMolecular weight:158.62861-Allyl-3-methyl-1H-imidazol-3-ium chloride
CAS:1-Allyl-3-methyl-1H-imidazol-3-ium chloridePurity:98%Molecular weight:158.63g/mol1-Allyl-3-methyl-3-imidazolium chloride
CAS:Formula:C7H11ClN2Purity:98%Color and Shape:LiquidMolecular weight:158.631-Allyl-3-methylimidazolium chloride
CAS:1-allyl-3-methylimidazolium-chloride (AMIM-Cl) may be used as a solvent to dissolve cellulose during the preparation of regenerated cellulose materials. It is also used as a solvent for the acetylation of cornhusk cellulose to form cornhusk cellulose acetates.
Formula:C7H11ClN2Purity:Min. 95%Molecular weight:158.63 g/mol





