CymitQuimica logo

CAS 65039-10-3

:

1-Allyl-3-methylimidazolium chloride

Description:
1-Allyl-3-methylimidazolium chloride is an ionic liquid, characterized by its low volatility and high thermal stability. It features a cation derived from imidazole, specifically with an allyl group and a methyl group at the 1 and 3 positions, respectively, which contributes to its unique properties. The chloride anion complements the cation, enhancing its solubility in various solvents and its ability to dissolve a wide range of organic and inorganic materials. This ionic liquid exhibits a relatively low melting point, making it liquid at room temperature, and it is known for its good electrochemical stability. Additionally, 1-Allyl-3-methylimidazolium chloride is often utilized in applications such as catalysis, extraction processes, and as a solvent in organic synthesis due to its tunable properties and ability to facilitate reactions. Its environmental impact is generally considered lower than that of traditional organic solvents, making it a subject of interest in green chemistry initiatives.
Formula:C7H11ClN2
InChI:InChI=1/C7H11N2.ClH/c1-3-4-9-6-5-8(2)7-9;/h3,5-7H,1,4H2,2H3;1H/q+1;/p-1
InChI key:QVRCRKLLQYOIKY-UHFFFAOYSA-M
SMILES:C[N+]1=CN(C=C1)CC=C.[Cl-]
Synonyms:
  • 1H-imidazolium, 1-methyl-3-(2-propen-1-yl)-, chloride (1:1)
  • 1-methyl-3-(prop-2-en-1-yl)-1H-imidazol-3-ium chloride
  • 3-methyl-1-(prop-2-en-1-yl)-1H-imidazol-3-ium chloride
  • 1-Allyl-Methylimidazolium Chloride
  • See more synonyms
Found 7 products.