CAS 65039-18-1: p-Dodecyloxynitrobenzene
Description:p-Dodecyloxynitrobenzene, with the CAS number 65039-18-1, is an organic compound characterized by its structure, which includes a dodecyl group (a long-chain alkyl group) attached to a nitro-substituted benzene ring. This compound typically exhibits hydrophobic properties due to the long dodecyl chain, making it less soluble in water but more soluble in organic solvents. The presence of the nitro group introduces polar characteristics, which can influence its reactivity and interactions with other chemical species. p-Dodecyloxynitrobenzene is often studied in the context of surfactants, as its amphiphilic nature allows it to reduce surface tension in solutions. Additionally, it may have applications in materials science and as a potential intermediate in organic synthesis. Its physical properties, such as melting point and boiling point, are influenced by the length of the alkyl chain and the presence of the nitro group, which can also affect its stability and reactivity under various conditions.
Formula:C18H29NO3
InChI:InChI=1/C18H29NO3/c1-2-3-4-5-6-7-8-9-10-11-16-22-18-14-12-17(13-15-18)19(20)21/h12-15H,2-11,16H2,1H3
- Synonyms:
- 4-n-Dodecyloxynitrobenzene
- p-Nitrophenyl Dodecyl Ether
- 1-(Dodecyloxy)-4-Nitrobenzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Dodecyloxy-4-nitrobenzene REF: 3B-D2029CAS: 65039-18-1 | >98.0%(GC) | 144.00 € | Tue 05 Aug 25 |
![]() | 4-N-DODECYLOXYNITROBENZENE REF: IN-DA003LTUCAS: 65039-18-1 | 98% | 46.00 €~161.00 € | Tue 12 Aug 25 |
![]() | P-Nitrophenyl Dodecyl Ether REF: 10-F342047CAS: 65039-18-1 | 98.0% | To inquire | Fri 22 Aug 25 |
![]() | 1-Dodecyloxy-4-nitrobenzene REF: 3D-QCA03918CAS: 65039-18-1 | Min. 95% | - - - | Discontinued product |

1-Dodecyloxy-4-nitrobenzene
Ref: 3B-D2029
25g | 144.00 € |

Ref: IN-DA003LTU
1g | 46.00 € | ||
5g | 71.00 € | ||
25g | 161.00 € |

Ref: 10-F342047
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

1-Dodecyloxy-4-nitrobenzene
Ref: 3D-QCA03918
100g | Discontinued | Request information | |
250g | Discontinued | Request information |