CAS 65087-59-4

Benzene, butyl-d9-(9CI)

Description:

Benzene, butyl-d9-(9CI) is a deuterated derivative of butylbenzene, where the butyl group is labeled with deuterium, a stable isotope of hydrogen. This compound is characterized by its aromatic structure, which consists of a benzene ring bonded to a butyl group. The presence of deuterium enhances its utility in various analytical techniques, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it can help in tracing molecular pathways and studying reaction mechanisms. The deuterium substitution can also influence the physical properties of the compound, such as its boiling point and solubility, compared to its non-deuterated counterparts. Benzene derivatives, including butylbenzene, are known for their applications in organic synthesis and as solvents. However, it is important to note that benzene and its derivatives are subject to regulations due to their potential health hazards, including carcinogenicity. Therefore, handling and usage of Benzene, butyl-d9-(9CI) should be conducted with appropriate safety measures in place.

Formula: C₁₀H₅D₉

InChI: InChI=1S/C10H14/c1-2-3-7-10-8-5-4-6-9-10/h4-6,8-9H,2-3,7H2,1H3/i1D3,2D2,3D2,7D2

InChI key: OCKPCBLVNKHBMX-AZOWHCDPSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=CC=C1

Synonyms:

• (n-Butyl-d9)benzene

n-Butyl-d9-benzene

CAS: 104-51-8, 65087-59-4

Formula: C₆H₅(CD₂)₃CD₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid.

Molecular weight: 143.16604

Ref: 3U-D1571

n-Butyl-d9-benzene

Controlled Product

CAS: 65087-59-4

Applications n-Butyl-d9-benzene (CAS# 65087-59-4) is a useful isotopically labeled research compound.

Formula: C₁₀D₉H₅

Color and Shape: Neat

Molecular weight: 143.274

Ref: TR-B690831