CymitQuimica logo

CAS 6509-19-9

:

adenine sulphate dihydrate

Description:
Adenine sulfate dihydrate, with the CAS number 6509-19-9, is a chemical compound that consists of adenine, a purine nucleobase, combined with sulfate groups and water molecules. It typically appears as a white to off-white crystalline solid. This compound is soluble in water, which facilitates its use in various biochemical applications. Adenine itself plays a crucial role in cellular processes, including energy transfer as part of adenosine triphosphate (ATP) and in the synthesis of nucleic acids. The presence of sulfate groups can influence its reactivity and interactions in biological systems. As a dihydrate, it contains two molecules of water for each molecule of adenine sulfate, which can affect its stability and solubility. In laboratory settings, adenine sulfate dihydrate may be utilized in research related to nucleic acid metabolism, cell signaling, and as a potential supplement in cell culture media. Proper handling and storage conditions are essential to maintain its integrity and effectiveness in experimental applications.
Formula:C5H11N5O6S
InChI:InChI=1/C5H5N5.H2O4S.2H2O/c6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4;;/h1-2H,(H3,6,7,8,9,10);(H2,1,2,3,4);2*1H2
InChI key:MKPCNMXYTMQZBE-UHFFFAOYSA-N
SMILES:c1nc2c(N)nc[nH]c2n1.OS(=O)(=O)O.O.O
Synonyms:
  • 9H-purin-6-amine
  • Sulfuric Acid
  • Dihydrate
Found 9 products.