CymitQuimica logo

CAS 651-84-3

:

2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenethiol

Description:
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzenethiol, with the CAS number 651-84-3, is a fluorinated aromatic compound characterized by the presence of multiple fluorine atoms and a thiol functional group. This compound features a benzene ring substituted with four fluorine atoms at the 2, 3, 5, and 6 positions, and a trifluoromethyl group at the para position (4). The presence of these electronegative fluorine atoms significantly influences its chemical properties, including increased stability and lipophilicity, while the thiol (-SH) group introduces reactivity typical of thiols, such as the ability to form disulfide bonds and participate in nucleophilic reactions. This compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds. Its unique structure makes it of interest in various applications, including materials science and organic synthesis, particularly in the development of fluorinated compounds with specific electronic and chemical properties. Safety precautions should be taken when handling this compound, as thiols can be malodorous and potentially toxic.
Formula:C7HF7S
InChI:InChI=1/C7HF7S/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H
InChI key:BXMOMKVOHOSVJH-UHFFFAOYSA-N
SMILES:c1(c(c(c(c(c1F)F)S)F)F)C(F)(F)F
Synonyms:
  • 2,3,5,6-Tetrafluor-4-(trifluormethyl)benzolthiol
  • Benzenethiol, 2,3,5,6-tetrafluoro-4-(trifluoromethyl)-
  • 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzenethiol
Found 4 products.