CymitQuimica logo

CAS 651-89-8

:

1,2,4,5-tetrafluoro-3,6-bis(trifluoromethyl)benzene

Description:
1,2,4,5-Tetrafluoro-3,6-bis(trifluoromethyl)benzene, with the CAS number 651-89-8, is a fluorinated aromatic compound characterized by the presence of four fluorine atoms and two trifluoromethyl groups attached to a benzene ring. This compound exhibits high thermal stability and chemical resistance due to the strong C-F bonds, making it useful in various industrial applications, including as a solvent and in the synthesis of other fluorinated compounds. Its unique electronic properties, influenced by the electronegative fluorine substituents, can lead to altered reactivity compared to non-fluorinated analogs. The presence of multiple fluorine atoms also contributes to its low surface energy and hydrophobic characteristics, which can be advantageous in applications requiring non-stick or water-repellent surfaces. Additionally, 1,2,4,5-tetrafluoro-3,6-bis(trifluoromethyl)benzene is typically handled with care due to potential environmental and health impacts associated with fluorinated compounds.
Formula:C8F10
InChI:InChI=1/C8F10/c9-3-1(7(13,14)15)4(10)6(12)2(5(3)11)8(16,17)18
SMILES:c1(c(c(c(c(c1F)F)C(F)(F)F)F)F)C(F)(F)F
Synonyms:
  • Benzene, 1,2,4,5-Tetrafluoro-3,6-Bis(Trifluoromethyl)-
  • Decafluoro-p-xylol
Found 1 products.