CymitQuimica logo

CAS 65113-25-9

:

1-[4-(1H-Imidazol-1-yl)phenyl]methanamine

Description:
1-[4-(1H-Imidazol-1-yl)phenyl]methanamine, with the CAS number 65113-25-9, is an organic compound characterized by its structure, which features an imidazole ring attached to a phenyl group, linked through a methanamine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amine and imidazole functional groups. It may display basic characteristics owing to the amine group, allowing it to participate in protonation reactions. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and can interact with biological targets. Additionally, the compound may exhibit moderate to high stability under standard conditions, although its reactivity can vary based on the presence of other functional groups or environmental factors. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.
Formula:C10H11N3
InChI:InChI=1/C10H11N3/c11-7-9-1-3-10(4-2-9)13-6-5-12-8-13/h1-6,8H,7,11H2
InChI key:MACCCEHTOQDLIP-UHFFFAOYSA-N
SMILES:c1cc(ccc1CN)n1ccnc1
Synonyms:
  • Benzenemethanamine, 4-(1H-imidazol-1-yl)-
  • 4-(1H-Imidazol-1-yl)benzylamine
Found 3 products.