CymitQuimica logo

CAS 65151-58-8

:

Phenol, 3,4-dimethyl-5-nitro-

Description:
Phenol, 3,4-dimethyl-5-nitro- is an organic compound characterized by a phenolic structure with specific substituents that influence its chemical properties. It features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted with two methyl groups at the 3 and 4 positions and a nitro group (-NO2) at the 5 position. This arrangement contributes to its reactivity and solubility in various solvents. The presence of the nitro group typically enhances the compound's electrophilic character, making it more reactive in certain chemical reactions, such as nitration or reduction. The methyl groups can provide steric hindrance, affecting the compound's reactivity and interaction with other molecules. Additionally, the compound may exhibit antimicrobial properties, which is common among phenolic compounds. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its specific reactivity and biological activity. Safety data should be consulted for handling and usage, as nitro-substituted phenols can pose health risks.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-5-3-7(10)4-8(6(5)2)9(11)12/h3-4,10H,1-2H3
InChI key:InChIKey=HKQSKINMCHAPPJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(C)=CC(O)=C1
Synonyms:
  • 3,4-Dimethyl-5-nitrophenol
  • 3,4-Xylenol, 5-nitro-
  • 3,4-Xylenol,5-nitro- (6CI)
  • Phenol, 3,4-dimethyl-5-nitro-
Found 3 products.