CAS 65154-06-5
:Blood platelet-activating factor
Description:
Blood platelet-activating factor (PAF), with the CAS number 65154-06-5, is a phospholipid mediator that plays a crucial role in various physiological and pathological processes, particularly in the immune response and inflammation. It is characterized by its ability to activate platelets, leading to aggregation and the release of various mediators. PAF is a potent bioactive lipid, typically produced by various cell types, including platelets, endothelial cells, and leukocytes. Its structure features an acetyl group at the sn-2 position of the glycerol backbone, which distinguishes it from other phospholipids. PAF is involved in numerous biological functions, such as promoting vascular permeability, influencing leukocyte trafficking, and modulating the release of inflammatory cytokines. Due to its significant role in inflammatory diseases, cardiovascular conditions, and allergic responses, PAF has garnered attention in pharmacological research, with potential therapeutic implications in managing these conditions. Its biological activity is mediated through specific receptors, known as PAF receptors, which are widely distributed in various tissues.
Formula:Unspecified
InChI:InChI=1/C12H26NO7P/c1-6-17-9-12(20-11(2)14)10-19-21(15,16)18-8-7-13(3,4)5/h12H,6-10H2,1-5H3/t12-/m1/s1
SMILES:CCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)C
Synonyms:- Platelet activating factor-acether
- Platelet-activating factor
- Blood platelet-activating factor
- PAF-acether
- Blood platelet activating factor-acether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-O-Hexadecyl-2-O-acetyl-sn-glycero-3-phosphocholine
CAS:1-O-Hexadecyl-2-O-acetyl-sn-glycero-3-phosphocholine is a phospholipid that is synthesized in the liver and has been shown to be a pressor agent. This drug has shown hypotensive effects in animal models, likely due to its ability to inhibit platelet aggregation and activate platelets. The mechanism of action of 1-O-hexadecyl 2-O-acetyl sn glycero 3 phosphate choline may be through inhibition of lipoxygenase and acetylcholine release, as well as an increase in tissue plasminogen activator (tPA) and plasminogen activator inhibitor (PAI).
Formula:C26H54NO7PPurity:Min. 95%Molecular weight:523.68 g/mol


