CymitQuimica logo

CAS 65160-71-6

:

N-Acetyl-D-tyrosine methyl ester

Description:
N-Acetyl-D-tyrosine methyl ester is a derivative of the amino acid tyrosine, characterized by the presence of an acetyl group and a methyl ester functional group. This compound is typically a white to off-white solid, soluble in organic solvents such as methanol and ethanol, but less soluble in water. It is often used in biochemical research and pharmaceutical applications due to its role in peptide synthesis and as a building block for various bioactive compounds. The acetylation of the amino group enhances the compound's stability and bioavailability, while the methyl ester group can influence its lipophilicity and permeability across biological membranes. N-Acetyl-D-tyrosine methyl ester may also exhibit antioxidant properties, making it of interest in studies related to oxidative stress and neuroprotection. As with many chemical substances, proper handling and safety precautions are essential, as it may pose risks if ingested or inhaled.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-8(14)13-11(12(16)17-2)7-9-3-5-10(15)6-4-9/h3-6,11,15H,7H2,1-2H3,(H,13,14)/t11-/m1/s1
InChI key:InChIKey=KRMVXLWZDYZILN-LLVKDONJSA-N
SMILES:[C@@H](CC1=CC=C(O)C=C1)(C(OC)=O)NC(C)=O
Synonyms:
  • N-Acetyl-D-tyrosine methyl ester
  • D-Tyrosine, N-acetyl-, methyl ester
Found 1 products.