CAS 65162-13-2
:1-Methoxyphenazine methosulfate
Description:
1-Methoxyphenazine methosulfate, with the CAS number 65162-13-2, is a chemical compound that belongs to the class of phenazine derivatives. It is characterized by its methoxy group, which enhances its solubility and reactivity. This compound typically appears as a solid or crystalline substance and is known for its use in various biochemical applications, particularly in the field of molecular biology and biochemistry. It often serves as a redox indicator or a dye due to its distinct color properties. The methosulfate moiety contributes to its stability and solubility in aqueous solutions, making it suitable for use in biological assays. Additionally, 1-Methoxyphenazine methosulfate may exhibit fluorescence, which can be advantageous in analytical techniques. As with many chemical substances, handling precautions should be observed, as it may pose health risks if ingested or inhaled. Overall, its unique structural features and properties make it a valuable tool in scientific research.
Formula:C14H13N2O·CH3O4S
InChI:InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1
InChI key:InChIKey=MASUWVVNWALEEM-UHFFFAOYSA-M
SMILES:O(C)C=1C2=C([N+](C)=C3C(=N2)C=CC=C3)C=CC1.S(OC)(=O)(=O)[O-]
Synonyms:- 1-Methoxy PMS
- 1-Methoxy-5-Methylphenazin-5-Ium Methyl Sulfate
- 1-Methoxy-5-methylphenazine methosulfate
- 1-Methoxy-5-methylphenazium methyl sulfate
- 1-Methoxyphenazine methosulfate
- Methoxy-PMS
- N-Methyl methoxyphenazinemethosulfate
- Phenazinium, 1-methoxy-5-methyl-, methyl sulfate
- Phenazinium, 1-methoxy-5-methyl-, methyl sulfate (1:1)
- 1-Methoxy-5-methylphenazinium methyl sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Methoxy-5-methylphenazinium Methyl Sulfate [for Biochemical Research]
CAS:Formula:C15H16N2O5SPurity:>95.0%(HPLC)Color and Shape:Orange to Brown to Dark purple powder to crystalMolecular weight:336.361-Methoxy-5-Methylphenazinium Methyl Sulfate
CAS:1-Methoxy-5-Methylphenazinium Methyl SulfateFormula:C15H16N2O5SPurity:99%Color and Shape:SolidMolecular weight:336.361-Methoxy-5-methylphenazinium methyl sulfate
CAS:Formula:C15H16N2O5SPurity:98%Color and Shape:SolidMolecular weight:336.3629Methoxy-PMS
CAS:Methoxy-PMSFormula:C15H16N2O5SPurity:≥95%Color and Shape:SolidMolecular weight:336.361-Methoxy-5-methylphenazinium methyl sulfate
CAS:Formula:C15H16N2O5SPurity:(HPLC) ≥ 95.0%Color and Shape:Red to orange or brown powderMolecular weight:336.36Methoxy-PMS
CAS:Methoxy-PMS (1-Methoxyphenazine methosulfate) is stable electron-transport mediator between NAD(P)H and tetrazolium dyes, can induce active oxygen formation.Formula:C15H16N2O5SPurity:96.18% - 99.33%Color and Shape:Dark Red Or Reddish Purple PowderMolecular weight:336.36






