CymitQuimica logo

CAS 65176-93-4

:

3-Pyridinecarbonitrile, 2-chloro-5,6-dimethyl-

Description:
3-Pyridinecarbonitrile, 2-chloro-5,6-dimethyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in various chemical syntheses. The presence of chlorine and two methyl groups at the 2, 5, and 6 positions of the pyridine ring influences its physical and chemical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate polarity due to the electronegative chlorine and cyano groups, which can affect their interactions in biological systems and chemical reactions. The compound may be used in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Pyridinecarbonitrile, 2-chloro-5,6-dimethyl- is a versatile compound with significant implications in chemical research and industry.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c1-5-3-7(4-10)8(9)11-6(5)2/h3H,1-2H3
InChI key:BYVPJDZJIHOUHA-UHFFFAOYSA-N
SMILES:CC1=CC(=C(N=C1C)Cl)C#N
Found 4 products.