
CAS 65188-70-7
:Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl ester, homopolymer
Description:
Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl ester, homopolymer, identified by CAS number 65188-70-7, is a synthetic polymer characterized by its ester functional groups and a backbone derived from butanoic acid. This compound typically exhibits properties associated with polyesters, including flexibility, durability, and resistance to various environmental factors. The presence of the 2-methyl-1-oxo-2-propen-1-yl moiety suggests that it may have reactive sites that can participate in further polymerization or cross-linking reactions, enhancing its structural integrity. The polymerization process can lead to a material with a range of molecular weights, influencing its physical properties such as melting point, solubility, and mechanical strength. Additionally, the ester linkages contribute to its potential biodegradability under certain conditions. Applications may include use in coatings, adhesives, or as a component in composite materials, where its unique chemical structure can provide specific performance characteristics. Overall, this compound represents a versatile class of materials with potential utility in various industrial applications.
Formula:(C10H14O5)x
InChI:InChI=1S/C10H14O5/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11/h1,4-6H2,2-3H3
InChI key:InChIKey=IBDVWXAVKPRHCU-UHFFFAOYSA-N
SMILES:O(CCOC(C(C)=C)=O)C(CC(C)=O)=O
Synonyms:- Poly[2-(acetoacetoxy)ethyl methacrylate]
- Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propenyl)oxy]ethyl ester, homopolymer
- Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl ester, homopolymer
- 2-(Acetoacetoxy)ethyl methacrylate homopolymer
- Acetoacetoxyethyl methacrylate homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanoic acid, 3-oxo-, 2-[(2-methyl-1-oxo-2-propen-1-yl)oxy]ethyl ester, homopolymer
CAS:Formula:C10H14O5Molecular weight:214.2152
